About carbanide;1-(2-methylphenyl)ethanone;tris(yttrium)
carbanide;1-(2-methylphenyl)ethanone;tris(yttrium) (PubChem CID 160605653) has the molecular formula C11H16OY3-2
and a molecular weight of 430.97 g/mol. Its IUPAC name is carbanide;1-(2-methylphenyl)ethanone;tris(yttrium).
Molecular Properties
| Compound Name | carbanide;1-(2-methylphenyl)ethanone;tris(yttrium) |
| PubChem CID | 160605653 |
| Molecular Formula | C11H16OY3-2 |
| Molecular Weight | 430.97 g/mol |
| Exact Mass | 430.84 |
| IUPAC Name | carbanide;1-(2-methylphenyl)ethanone;tris(yttrium) |
| SMILES | CC(=O)c1ccccc1C.[CH3-].[CH3-].[Y].[Y].[Y] |
| InChI | InChI=1S/C9H10O.2CH3.3Y/c1-7-5-3-4-6-9(7)8(2)10;;;;;/h3-6H,1-2H3;2*1H3;;;/q;2*-1;;; |
| InChIKey | OXZIYMBPDPVQDY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.97 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;1-(2-methylphenyl)ethanone;tris(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;1-(2-methylphenyl)ethanone;tris(yttrium)?
The IUPAC name of carbanide;1-(2-methylphenyl)ethanone;tris(yttrium) (CID 160605653) is carbanide;1-(2-methylphenyl)ethanone;tris(yttrium).
What is the SMILES notation for carbanide;1-(2-methylphenyl)ethanone;tris(yttrium)?
The canonical SMILES for carbanide;1-(2-methylphenyl)ethanone;tris(yttrium) is CC(=O)c1ccccc1C.[CH3-].[CH3-].[Y].[Y].[Y].
What is the InChIKey of carbanide;1-(2-methylphenyl)ethanone;tris(yttrium)?
The InChIKey is OXZIYMBPDPVQDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.2CH3.3Y/c1-7-5-3-4-6-9(7)8(2)10;;;;;/h3-6H,1-2H3;2*1H3;;;/q;2*-1;;;.
What are the key properties of carbanide;1-(2-methylphenyl)ethanone;tris(yttrium)?
carbanide;1-(2-methylphenyl)ethanone;tris(yttrium) has a molecular weight of 430.97 g/mol, XLogP of 3.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;1-(2-methylphenyl)ethanone;tris(yttrium) is sourced from PubChem (CID 160605653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).