C9H10O — CID 10486909
2,2,2-trideuterio-1-(2-methylphenyl)ethanone (PubChem CID 10486909) has the molecular formula C9H10O and a molecular weight of 137.20 g/mol. Its IUPAC name is 2,2,2-trideuterio-1-(2-methylphenyl)ethanone.
| Compound Name | 2,2,2-trideuterio-1-(2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 10486909 |
| Molecular Formula | C9H10O |
| Molecular Weight | 137.20 g/mol |
| Exact Mass | 137.09 |
| IUPAC Name | 2,2,2-trideuterio-1-(2-methylphenyl)ethanone |
| SMILES | [2H]C([2H])([2H])C(=O)c1ccccc1C |
| InChI | InChI=1S/C9H10O/c1-7-5-3-4-6-9(7)8(2)10/h3-6H,1-2H3/i2D3 |
| InChIKey | YXWWHNCQZBVZPV-BMSJAHLVSA-N |
| XLogP | 2.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |