C8H8O2 — CID 102513692
2,2,2-trideuterio-1-(2-hydroxyphenyl)ethanone (PubChem CID 102513692) has the molecular formula C8H8O2 and a molecular weight of 139.17 g/mol. Its IUPAC name is 2,2,2-trideuterio-1-(2-hydroxyphenyl)ethanone.
| Compound Name | 2,2,2-trideuterio-1-(2-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 102513692 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | 2,2,2-trideuterio-1-(2-hydroxyphenyl)ethanone |
| SMILES | [2H]C([2H])([2H])C(=O)c1ccccc1O |
| InChI | InChI=1S/C8H8O2/c1-6(9)7-4-2-3-5-8(7)10/h2-5,10H,1H3/i1D3 |
| InChIKey | JECYUBVRTQDVAT-FIBGUPNXSA-N |
| XLogP | 1.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |