About cerium;1-(2-hydroxyphenyl)ethanone
cerium;1-(2-hydroxyphenyl)ethanone (PubChem CID 174280590) has the molecular formula C8H8CeO2
and a molecular weight of 276.27 g/mol. Its IUPAC name is cerium;1-(2-hydroxyphenyl)ethanone.
Molecular Properties
| Compound Name | cerium;1-(2-hydroxyphenyl)ethanone |
| PubChem CID | 174280590 |
| Molecular Formula | C8H8CeO2 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 275.96 |
| IUPAC Name | cerium;1-(2-hydroxyphenyl)ethanone |
| SMILES | CC(=O)c1ccccc1O.[Ce] |
| InChI | InChI=1S/C8H8O2.Ce/c1-6(9)7-4-2-3-5-8(7)10;/h2-5,10H,1H3; |
| InChIKey | CVXSOWWMKYPXJV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cerium;1-(2-hydroxyphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cerium;1-(2-hydroxyphenyl)ethanone?
The IUPAC name of cerium;1-(2-hydroxyphenyl)ethanone (CID 174280590) is cerium;1-(2-hydroxyphenyl)ethanone.
What is the SMILES notation for cerium;1-(2-hydroxyphenyl)ethanone?
The canonical SMILES for cerium;1-(2-hydroxyphenyl)ethanone is CC(=O)c1ccccc1O.[Ce].
What is the InChIKey of cerium;1-(2-hydroxyphenyl)ethanone?
The InChIKey is CVXSOWWMKYPXJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.Ce/c1-6(9)7-4-2-3-5-8(7)10;/h2-5,10H,1H3;.
What are the key properties of cerium;1-(2-hydroxyphenyl)ethanone?
cerium;1-(2-hydroxyphenyl)ethanone has a molecular weight of 276.27 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cerium;1-(2-hydroxyphenyl)ethanone is sourced from PubChem (CID 174280590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).