About sodium;2-hydroxybenzoic acid;acetate
sodium;2-hydroxybenzoic acid;acetate (PubChem CID 174935764) has the molecular formula C9H9NaO5
and a molecular weight of 220.16 g/mol. Its IUPAC name is sodium;2-hydroxybenzoic acid;acetate.
Molecular Properties
| Compound Name | sodium;2-hydroxybenzoic acid;acetate |
| PubChem CID | 174935764 |
| Molecular Formula | C9H9NaO5 |
| Molecular Weight | 220.16 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | sodium;2-hydroxybenzoic acid;acetate |
| SMILES | CC(=O)[O-].O=C(O)c1ccccc1O.[Na+] |
| InChI | InChI=1S/C7H6O3.C2H4O2.Na/c8-6-4-2-1-3-5(6)7(9)10;1-2(3)4;/h1-4,8H,(H,9,10);1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | NSHOJRPLRMIZCF-UHFFFAOYSA-M |
| XLogP | -3.15 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.16 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium;2-hydroxybenzoic acid;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-hydroxybenzoic acid;acetate?
The IUPAC name of sodium;2-hydroxybenzoic acid;acetate (CID 174935764) is sodium;2-hydroxybenzoic acid;acetate.
What is the SMILES notation for sodium;2-hydroxybenzoic acid;acetate?
The canonical SMILES for sodium;2-hydroxybenzoic acid;acetate is CC(=O)[O-].O=C(O)c1ccccc1O.[Na+].
What is the InChIKey of sodium;2-hydroxybenzoic acid;acetate?
The InChIKey is NSHOJRPLRMIZCF-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O3.C2H4O2.Na/c8-6-4-2-1-3-5(6)7(9)10;1-2(3)4;/h1-4,8H,(H,9,10);1H3,(H,3,4);/q;;+1/p-1.
What are the key properties of sodium;2-hydroxybenzoic acid;acetate?
sodium;2-hydroxybenzoic acid;acetate has a molecular weight of 220.16 g/mol, XLogP of -3.15, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-hydroxybenzoic acid;acetate is sourced from PubChem (CID 174935764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).