About butylcyclobutane;1-(2-hydroxyphenyl)ethanone
butylcyclobutane;1-(2-hydroxyphenyl)ethanone (PubChem CID 67882317) has the molecular formula C16H24O2
and a molecular weight of 248.37 g/mol. Its IUPAC name is butylcyclobutane;1-(2-hydroxyphenyl)ethanone.
Molecular Properties
| Compound Name | butylcyclobutane;1-(2-hydroxyphenyl)ethanone |
| PubChem CID | 67882317 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | butylcyclobutane;1-(2-hydroxyphenyl)ethanone |
| SMILES | CC(=O)c1ccccc1O.CCCCC1CCC1 |
| InChI | InChI=1S/C8H8O2.C8H16/c1-6(9)7-4-2-3-5-8(7)10;1-2-3-5-8-6-4-7-8/h2-5,10H,1H3;8H,2-7H2,1H3 |
| InChIKey | OERLWDGMCRIMBE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butylcyclobutane;1-(2-hydroxyphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylcyclobutane;1-(2-hydroxyphenyl)ethanone?
The IUPAC name of butylcyclobutane;1-(2-hydroxyphenyl)ethanone (CID 67882317) is butylcyclobutane;1-(2-hydroxyphenyl)ethanone.
What is the SMILES notation for butylcyclobutane;1-(2-hydroxyphenyl)ethanone?
The canonical SMILES for butylcyclobutane;1-(2-hydroxyphenyl)ethanone is CC(=O)c1ccccc1O.CCCCC1CCC1.
What is the InChIKey of butylcyclobutane;1-(2-hydroxyphenyl)ethanone?
The InChIKey is OERLWDGMCRIMBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C8H16/c1-6(9)7-4-2-3-5-8(7)10;1-2-3-5-8-6-4-7-8/h2-5,10H,1H3;8H,2-7H2,1H3.
What are the key properties of butylcyclobutane;1-(2-hydroxyphenyl)ethanone?
butylcyclobutane;1-(2-hydroxyphenyl)ethanone has a molecular weight of 248.37 g/mol, XLogP of 4.57, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butylcyclobutane;1-(2-hydroxyphenyl)ethanone is sourced from PubChem (CID 67882317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).