C20H28O4 — CID 7311848
2-[(1S)-1-(4-butylcyclohexyl)ethoxy]carbonylbenzoic acid (PubChem CID 7311848) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 2-[(1S)-1-(4-butylcyclohexyl)ethoxy]carbonylbenzoic acid.
| Compound Name | 2-[(1S)-1-(4-butylcyclohexyl)ethoxy]carbonylbenzoic acid |
|---|---|
| PubChem CID | 7311848 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-[(1S)-1-(4-butylcyclohexyl)ethoxy]carbonylbenzoic acid |
| SMILES | CCCCC1CCC([C@H](C)OC(=O)c2ccccc2C(=O)O)CC1 |
| InChI | InChI=1S/C20H28O4/c1-3-4-7-15-10-12-16(13-11-15)14(2)24-20(23)18-9-6-5-8-17(18)19(21)22/h5-6,8-9,14-16H,3-4,7,10-13H2,1-2H3,(H,21,22)/t14-,15?,16?/m0/s1 |
| InChIKey | PVGZFRRNZJEOQV-FHERZECASA-N |
| XLogP | 4.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |