C32H54O4 — CID 141231360
2-(9-hexyloctadecan-9-yloxycarbonyl)benzoic acid (PubChem CID 141231360) has the molecular formula C32H54O4 and a molecular weight of 502.78 g/mol. Its IUPAC name is 2-(9-hexyloctadecan-9-yloxycarbonyl)benzoic acid.
| Compound Name | 2-(9-hexyloctadecan-9-yloxycarbonyl)benzoic acid |
|---|---|
| PubChem CID | 141231360 |
| Molecular Formula | C32H54O4 |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 502.40 |
| IUPAC Name | 2-(9-hexyloctadecan-9-yloxycarbonyl)benzoic acid |
| SMILES | CCCCCCCCCC(CCCCCC)(CCCCCCCC)OC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C32H54O4/c1-4-7-10-13-15-17-22-27-32(25-20-12-9-6-3,26-21-16-14-11-8-5-2)36-31(35)29-24-19-18-23-28(29)30(33)34/h18-19,23-24H,4-17,20-22,25-27H2,1-3H3,(H,33,34) |
| InChIKey | JZDXBDPCMKBURZ-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.78 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|