C36H62O4 — CID 70543205
bis(5-butyldecan-5-yl) benzene-1,2-dicarboxylate (PubChem CID 70543205) has the molecular formula C36H62O4 and a molecular weight of 558.89 g/mol. Its IUPAC name is bis(5-butyldecan-5-yl) benzene-1,2-dicarboxylate.
| Compound Name | bis(5-butyldecan-5-yl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 70543205 |
| Molecular Formula | C36H62O4 |
| Molecular Weight | 558.89 g/mol |
| Exact Mass | 558.46 |
| IUPAC Name | bis(5-butyldecan-5-yl) benzene-1,2-dicarboxylate |
| SMILES | CCCCCC(CCCC)(CCCC)OC(=O)c1ccccc1C(=O)OC(CCCC)(CCCC)CCCCC |
| InChI | InChI=1S/C36H62O4/c1-7-13-21-29-35(25-15-9-3,26-16-10-4)39-33(37)31-23-19-20-24-32(31)34(38)40-36(27-17-11-5,28-18-12-6)30-22-14-8-2/h19-20,23-24H,7-18,21-22,25-30H2,1-6H3 |
| InChIKey | CHNJNPXUVDDQCR-UHFFFAOYSA-N |
| XLogP | 11.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.89 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|