C24H37IO4 — CID 69124798
bis(2-methylheptan-2-yl) 3-iodobenzene-1,2-dicarboxylate (PubChem CID 69124798) has the molecular formula C24H37IO4 and a molecular weight of 516.46 g/mol. Its IUPAC name is bis(2-methylheptan-2-yl) 3-iodobenzene-1,2-dicarboxylate.
| Compound Name | bis(2-methylheptan-2-yl) 3-iodobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 69124798 |
| Molecular Formula | C24H37IO4 |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | bis(2-methylheptan-2-yl) 3-iodobenzene-1,2-dicarboxylate |
| SMILES | CCCCCC(C)(C)OC(=O)c1cccc(I)c1C(=O)OC(C)(C)CCCCC |
| InChI | InChI=1S/C24H37IO4/c1-7-9-11-16-23(3,4)28-21(26)18-14-13-15-19(25)20(18)22(27)29-24(5,6)17-12-10-8-2/h13-15H,7-12,16-17H2,1-6H3 |
| InChIKey | CFEYTILXZPSIDU-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|