C19H28O4 — CID 141242494
2-(2-methyldecan-3-yloxycarbonyl)benzoic acid (PubChem CID 141242494) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is 2-(2-methyldecan-3-yloxycarbonyl)benzoic acid.
| Compound Name | 2-(2-methyldecan-3-yloxycarbonyl)benzoic acid |
|---|---|
| PubChem CID | 141242494 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 2-(2-methyldecan-3-yloxycarbonyl)benzoic acid |
| SMILES | CCCCCCCC(OC(=O)c1ccccc1C(=O)O)C(C)C |
| InChI | InChI=1S/C19H28O4/c1-4-5-6-7-8-13-17(14(2)3)23-19(22)16-12-10-9-11-15(16)18(20)21/h9-12,14,17H,4-8,13H2,1-3H3,(H,20,21) |
| InChIKey | VQRDXKYWXCFPMQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|