C16H21BrO4 — CID 139909226
2-bromo-6-(2-methylheptan-3-yloxycarbonyl)benzoic acid (PubChem CID 139909226) has the molecular formula C16H21BrO4 and a molecular weight of 357.24 g/mol. Its IUPAC name is 2-bromo-6-(2-methylheptan-3-yloxycarbonyl)benzoic acid.
| Compound Name | 2-bromo-6-(2-methylheptan-3-yloxycarbonyl)benzoic acid |
|---|---|
| PubChem CID | 139909226 |
| Molecular Formula | C16H21BrO4 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2-bromo-6-(2-methylheptan-3-yloxycarbonyl)benzoic acid |
| SMILES | CCCCC(OC(=O)c1cccc(Br)c1C(=O)O)C(C)C |
| InChI | InChI=1S/C16H21BrO4/c1-4-5-9-13(10(2)3)21-16(20)11-7-6-8-12(17)14(11)15(18)19/h6-8,10,13H,4-5,9H2,1-3H3,(H,18,19) |
| InChIKey | CRMBROGIGOGDEJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |