C26H42O4 — CID 69124663
bis(2-methylheptan-3-yl) 4-ethylbenzene-1,2-dicarboxylate (PubChem CID 69124663) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is bis(2-methylheptan-3-yl) 4-ethylbenzene-1,2-dicarboxylate.
| Compound Name | bis(2-methylheptan-3-yl) 4-ethylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 69124663 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | bis(2-methylheptan-3-yl) 4-ethylbenzene-1,2-dicarboxylate |
| SMILES | CCCCC(OC(=O)c1ccc(CC)cc1C(=O)OC(CCCC)C(C)C)C(C)C |
| InChI | InChI=1S/C26H42O4/c1-8-11-13-23(18(4)5)29-25(27)21-16-15-20(10-3)17-22(21)26(28)30-24(19(6)7)14-12-9-2/h15-19,23-24H,8-14H2,1-7H3 |
| InChIKey | WUVSMAQXSIZUMG-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |