C31H44O4 — CID 23125991
[5-(4-butylbenzoyl)oxy-2,6-dimethylheptan-3-yl] 4-butylbenzoate (PubChem CID 23125991) has the molecular formula C31H44O4 and a molecular weight of 480.69 g/mol. Its IUPAC name is [5-(4-butylbenzoyl)oxy-2,6-dimethylheptan-3-yl] 4-butylbenzoate.
| Compound Name | [5-(4-butylbenzoyl)oxy-2,6-dimethylheptan-3-yl] 4-butylbenzoate |
|---|---|
| PubChem CID | 23125991 |
| Molecular Formula | C31H44O4 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | [5-(4-butylbenzoyl)oxy-2,6-dimethylheptan-3-yl] 4-butylbenzoate |
| SMILES | CCCCc1ccc(C(=O)OC(CC(OC(=O)c2ccc(CCCC)cc2)C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C31H44O4/c1-7-9-11-24-13-17-26(18-14-24)30(32)34-28(22(3)4)21-29(23(5)6)35-31(33)27-19-15-25(16-20-27)12-10-8-2/h13-20,22-23,28-29H,7-12,21H2,1-6H3 |
| InChIKey | VDOCDNGSCFIURT-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |