C20H30O4 — CID 66629183
bis(2-methylpentan-3-yl) benzene-1,2-dicarboxylate (PubChem CID 66629183) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is bis(2-methylpentan-3-yl) benzene-1,2-dicarboxylate.
| Compound Name | bis(2-methylpentan-3-yl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 66629183 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | bis(2-methylpentan-3-yl) benzene-1,2-dicarboxylate |
| SMILES | CCC(OC(=O)c1ccccc1C(=O)OC(CC)C(C)C)C(C)C |
| InChI | InChI=1S/C20H30O4/c1-7-17(13(3)4)23-19(21)15-11-9-10-12-16(15)20(22)24-18(8-2)14(5)6/h9-14,17-18H,7-8H2,1-6H3 |
| InChIKey | ZLNLFXCARHAEHE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |