C17H24O4 — CID 139911678
4-ethyl-5-methyl-2-(2-methylpentan-3-yloxycarbonyl)benzoic acid (PubChem CID 139911678) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-ethyl-5-methyl-2-(2-methylpentan-3-yloxycarbonyl)benzoic acid.
| Compound Name | 4-ethyl-5-methyl-2-(2-methylpentan-3-yloxycarbonyl)benzoic acid |
|---|---|
| PubChem CID | 139911678 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 4-ethyl-5-methyl-2-(2-methylpentan-3-yloxycarbonyl)benzoic acid |
| SMILES | CCc1cc(C(=O)OC(CC)C(C)C)c(C(=O)O)cc1C |
| InChI | InChI=1S/C17H24O4/c1-6-12-9-14(13(16(18)19)8-11(12)5)17(20)21-15(7-2)10(3)4/h8-10,15H,6-7H2,1-5H3,(H,18,19) |
| InChIKey | USTWIKXFXHILKI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |