C18H25BrO4 — CID 139911687
5-bromo-4-ethyl-2-(6-methylheptan-3-yloxycarbonyl)benzoic acid (PubChem CID 139911687) has the molecular formula C18H25BrO4 and a molecular weight of 385.30 g/mol. Its IUPAC name is 5-bromo-4-ethyl-2-(6-methylheptan-3-yloxycarbonyl)benzoic acid.
| Compound Name | 5-bromo-4-ethyl-2-(6-methylheptan-3-yloxycarbonyl)benzoic acid |
|---|---|
| PubChem CID | 139911687 |
| Molecular Formula | C18H25BrO4 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 5-bromo-4-ethyl-2-(6-methylheptan-3-yloxycarbonyl)benzoic acid |
| SMILES | CCc1cc(C(=O)OC(CC)CCC(C)C)c(C(=O)O)cc1Br |
| InChI | InChI=1S/C18H25BrO4/c1-5-12-9-15(14(17(20)21)10-16(12)19)18(22)23-13(6-2)8-7-11(3)4/h9-11,13H,5-8H2,1-4H3,(H,20,21) |
| InChIKey | XGHBHZNDXQOCDE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |