C24H36Cl2O4 — CID 69125562
bis(6-methylheptan-3-yl) 4,5-dichlorobenzene-1,2-dicarboxylate (PubChem CID 69125562) has the molecular formula C24H36Cl2O4 and a molecular weight of 459.45 g/mol. Its IUPAC name is bis(6-methylheptan-3-yl) 4,5-dichlorobenzene-1,2-dicarboxylate.
| Compound Name | bis(6-methylheptan-3-yl) 4,5-dichlorobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 69125562 |
| Molecular Formula | C24H36Cl2O4 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | bis(6-methylheptan-3-yl) 4,5-dichlorobenzene-1,2-dicarboxylate |
| SMILES | CCC(CCC(C)C)OC(=O)c1cc(Cl)c(Cl)cc1C(=O)OC(CC)CCC(C)C |
| InChI | InChI=1S/C24H36Cl2O4/c1-7-17(11-9-15(3)4)29-23(27)19-13-21(25)22(26)14-20(19)24(28)30-18(8-2)12-10-16(5)6/h13-18H,7-12H2,1-6H3 |
| InChIKey | JMBBABSMBMDHML-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |