C28H45FO4 — CID 69124711
bis(2-methylnonan-5-yl) 4-fluorobenzene-1,2-dicarboxylate (PubChem CID 69124711) has the molecular formula C28H45FO4 and a molecular weight of 464.66 g/mol. Its IUPAC name is bis(2-methylnonan-5-yl) 4-fluorobenzene-1,2-dicarboxylate.
| Compound Name | bis(2-methylnonan-5-yl) 4-fluorobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 69124711 |
| Molecular Formula | C28H45FO4 |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | bis(2-methylnonan-5-yl) 4-fluorobenzene-1,2-dicarboxylate |
| SMILES | CCCCC(CCC(C)C)OC(=O)c1ccc(F)cc1C(=O)OC(CCCC)CCC(C)C |
| InChI | InChI=1S/C28H45FO4/c1-7-9-11-23(16-13-20(3)4)32-27(30)25-18-15-22(29)19-26(25)28(31)33-24(12-10-8-2)17-14-21(5)6/h15,18-21,23-24H,7-14,16-17H2,1-6H3 |
| InChIKey | NPLYZKNINWNABN-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |