C19H27BrO4 — CID 69124389
5-bromo-4-methyl-2-(2-methylnonan-5-yloxycarbonyl)benzoic acid (PubChem CID 69124389) has the molecular formula C19H27BrO4 and a molecular weight of 399.33 g/mol. Its IUPAC name is 5-bromo-4-methyl-2-(2-methylnonan-5-yloxycarbonyl)benzoic acid.
| Compound Name | 5-bromo-4-methyl-2-(2-methylnonan-5-yloxycarbonyl)benzoic acid |
|---|---|
| PubChem CID | 69124389 |
| Molecular Formula | C19H27BrO4 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 5-bromo-4-methyl-2-(2-methylnonan-5-yloxycarbonyl)benzoic acid |
| SMILES | CCCCC(CCC(C)C)OC(=O)c1cc(C)c(Br)cc1C(=O)O |
| InChI | InChI=1S/C19H27BrO4/c1-5-6-7-14(9-8-12(2)3)24-19(23)16-10-13(4)17(20)11-15(16)18(21)22/h10-12,14H,5-9H2,1-4H3,(H,21,22) |
| InChIKey | MFWYRSSXAKVLAM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |