C24H24Br4O8 — CID 158829368
4,5-dibromophthalic acid;dibutyl 4,5-dibromobenzene-1,2-dicarboxylate (PubChem CID 158829368) has the molecular formula C24H24Br4O8 and a molecular weight of 760.06 g/mol. Its IUPAC name is 4,5-dibromophthalic acid;dibutyl 4,5-dibromobenzene-1,2-dicarboxylate.
| Compound Name | 4,5-dibromophthalic acid;dibutyl 4,5-dibromobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 158829368 |
| Molecular Formula | C24H24Br4O8 |
| Molecular Weight | 760.06 g/mol |
| Exact Mass | 755.82 |
| IUPAC Name | 4,5-dibromophthalic acid;dibutyl 4,5-dibromobenzene-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)c1cc(Br)c(Br)cc1C(=O)OCCCC.O=C(O)c1cc(Br)c(Br)cc1C(=O)O |
| InChI | InChI=1S/C16H20Br2O4.C8H4Br2O4/c1-3-5-7-21-15(19)11-9-13(17)14(18)10-12(11)16(20)22-8-6-4-2;9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h9-10H,3-8H2,1-2H3;1-2H,(H,11,12)(H,13,14) |
| InChIKey | IWVVLDNKIGQJBZ-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.06 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|