5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid

C13H12O9 — CID 141230542

IUPAC5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)c(C(=O)OCCCO)cc1C(=O)O
InChIInChI=1S/C13H12O9/c14-2-1-3-22-13(21)9-5-7(11(17)18)6(10(15)16)4-8(9)12(19)20/h4-5,14H,1-3H2,(H,15,16)(H,17,18)(H,19,20)
InChIKeySPWHFOVSRQHJEC-UHFFFAOYSA-N
MW312.23 g/mol
LogP0.32
Rot. Bonds7

About 5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid

5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid (PubChem CID 141230542) has the molecular formula C13H12O9 and a molecular weight of 312.23 g/mol. Its IUPAC name is 5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid.

Molecular Properties

Compound Name5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid
PubChem CID141230542
Molecular FormulaC13H12O9
Molecular Weight312.23 g/mol
Exact Mass312.05
IUPAC Name5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)c(C(=O)OCCCO)cc1C(=O)O
InChIInChI=1S/C13H12O9/c14-2-1-3-22-13(21)9-5-7(11(17)18)6(10(15)16)4-8(9)12(19)20/h4-5,14H,1-3H2,(H,15,16)(H,17,18)(H,19,20)
InChIKeySPWHFOVSRQHJEC-UHFFFAOYSA-N
XLogP0.32
TPSA158.43 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.23
LogP ≤ 50.32
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid?
The IUPAC name of 5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid (CID 141230542) is 5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid.
What is the SMILES notation for 5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid?
The canonical SMILES for 5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid is O=C(O)c1cc(C(=O)O)c(C(=O)OCCCO)cc1C(=O)O.
What is the InChIKey of 5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid?
The InChIKey is SPWHFOVSRQHJEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O9/c14-2-1-3-22-13(21)9-5-7(11(17)18)6(10(15)16)4-8(9)12(19)20/h4-5,14H,1-3H2,(H,15,16)(H,17,18)(H,19,20).
What are the key properties of 5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid?
5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid has a molecular weight of 312.23 g/mol, XLogP of 0.32, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-hydroxypropoxycarbonyl)benzene-1,2,4-tricarboxylic acid is sourced from PubChem (CID 141230542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).