C16H22O7 — CID 20519540
4-(4-hydroxybutoxycarbonyl)-2,3-bis(2-hydroxyethyl)benzoic acid (PubChem CID 20519540) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is 4-(4-hydroxybutoxycarbonyl)-2,3-bis(2-hydroxyethyl)benzoic acid.
| Compound Name | 4-(4-hydroxybutoxycarbonyl)-2,3-bis(2-hydroxyethyl)benzoic acid |
|---|---|
| PubChem CID | 20519540 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 4-(4-hydroxybutoxycarbonyl)-2,3-bis(2-hydroxyethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)OCCCCO)c(CCO)c1CCO |
| InChI | InChI=1S/C16H22O7/c17-7-1-2-10-23-16(22)14-4-3-13(15(20)21)11(5-8-18)12(14)6-9-19/h3-4,17-19H,1-2,5-10H2,(H,20,21) |
| InChIKey | USVRSESWRSWCAQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|