C13H16O6 — CID 175802536
2-(2-hydroxyethyl)-3-(3-hydroxypropyl)terephthalic acid (PubChem CID 175802536) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-3-(3-hydroxypropyl)terephthalic acid.
| Compound Name | 2-(2-hydroxyethyl)-3-(3-hydroxypropyl)terephthalic acid |
|---|---|
| PubChem CID | 175802536 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-(2-hydroxyethyl)-3-(3-hydroxypropyl)terephthalic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)c(CCCO)c1CCO |
| InChI | InChI=1S/C13H16O6/c14-6-1-2-8-9(5-7-15)11(13(18)19)4-3-10(8)12(16)17/h3-4,14-15H,1-2,5-7H2,(H,16,17)(H,18,19) |
| InChIKey | ZMXZNDFDEIMULG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |