C17H16O3 — CID 141108943
1-(3-hydroxypropyl)-9H-fluorene-2-carboxylic acid (PubChem CID 141108943) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-9H-fluorene-2-carboxylic acid.
| Compound Name | 1-(3-hydroxypropyl)-9H-fluorene-2-carboxylic acid |
|---|---|
| PubChem CID | 141108943 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-(3-hydroxypropyl)-9H-fluorene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1CCCO)Cc1ccccc1-2 |
| InChI | InChI=1S/C17H16O3/c18-9-3-6-13-15(17(19)20)8-7-14-12-5-2-1-4-11(12)10-16(13)14/h1-2,4-5,7-8,18H,3,6,9-10H2,(H,19,20) |
| InChIKey | AWEGRFNADLKGCN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |