C18H14O4 — CID 139570537
1-prop-2-enyl-9H-fluorene-2,3-dicarboxylic acid (PubChem CID 139570537) has the molecular formula C18H14O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-prop-2-enyl-9H-fluorene-2,3-dicarboxylic acid.
| Compound Name | 1-prop-2-enyl-9H-fluorene-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 139570537 |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-prop-2-enyl-9H-fluorene-2,3-dicarboxylic acid |
| SMILES | C=CCc1c2c(cc(C(=O)O)c1C(=O)O)-c1ccccc1C2 |
| InChI | InChI=1S/C18H14O4/c1-2-5-12-13-8-10-6-3-4-7-11(10)14(13)9-15(17(19)20)16(12)18(21)22/h2-4,6-7,9H,1,5,8H2,(H,19,20)(H,21,22) |
| InChIKey | VNGSBQVZGTZYSG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|