C18H16O4 — CID 66633539
3-benzyl-4-prop-2-enylphthalic acid (PubChem CID 66633539) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is 3-benzyl-4-prop-2-enylphthalic acid.
| Compound Name | 3-benzyl-4-prop-2-enylphthalic acid |
|---|---|
| PubChem CID | 66633539 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-benzyl-4-prop-2-enylphthalic acid |
| SMILES | C=CCc1ccc(C(=O)O)c(C(=O)O)c1Cc1ccccc1 |
| InChI | InChI=1S/C18H16O4/c1-2-6-13-9-10-14(17(19)20)16(18(21)22)15(13)11-12-7-4-3-5-8-12/h2-5,7-10H,1,6,11H2,(H,19,20)(H,21,22) |
| InChIKey | QXTGVSMRUSKTAP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|