C26H24N2O4S2 — CID 67680841
3,4-bis(3-amino-3-phenylsulfanylprop-2-enyl)phthalic acid (PubChem CID 67680841) has the molecular formula C26H24N2O4S2 and a molecular weight of 492.62 g/mol. Its IUPAC name is 3,4-bis(3-amino-3-phenylsulfanylprop-2-enyl)phthalic acid.
| Compound Name | 3,4-bis(3-amino-3-phenylsulfanylprop-2-enyl)phthalic acid |
|---|---|
| PubChem CID | 67680841 |
| Molecular Formula | C26H24N2O4S2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 3,4-bis(3-amino-3-phenylsulfanylprop-2-enyl)phthalic acid |
| SMILES | NC(=CCc1ccc(C(=O)O)c(C(=O)O)c1CC=C(N)Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C26H24N2O4S2/c27-22(33-18-7-3-1-4-8-18)15-12-17-11-13-21(25(29)30)24(26(31)32)20(17)14-16-23(28)34-19-9-5-2-6-10-19/h1-11,13,15-16H,12,14,27-28H2,(H,29,30)(H,31,32) |
| InChIKey | SPMORDZGOZBFJE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |