C10H6O8Ti — CID 162026487
benzene-1,2,3,4-tetracarboxylic acid;titanium (PubChem CID 162026487) has the molecular formula C10H6O8Ti and a molecular weight of 302.02 g/mol. Its IUPAC name is benzene-1,2,3,4-tetracarboxylic acid;titanium.
| Compound Name | benzene-1,2,3,4-tetracarboxylic acid;titanium |
|---|---|
| PubChem CID | 162026487 |
| Molecular Formula | C10H6O8Ti |
| Molecular Weight | 302.02 g/mol |
| Exact Mass | 301.95 |
| IUPAC Name | benzene-1,2,3,4-tetracarboxylic acid;titanium |
| SMILES | O=C(O)c1ccc(C(=O)O)c(C(=O)O)c1C(=O)O.[Ti] |
| InChI | InChI=1S/C10H6O8.Ti/c11-7(12)3-1-2-4(8(13)14)6(10(17)18)5(3)9(15)16;/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18); |
| InChIKey | YVLCKFXSGPTRNP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.02 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |