C22H42N4O12 — CID 173051474
benzene-1,2,3,4-tetracarboxylic acid;tetrakis(2-(methylamino)ethanol) (PubChem CID 173051474) has the molecular formula C22H42N4O12 and a molecular weight of 554.59 g/mol. Its IUPAC name is benzene-1,2,3,4-tetracarboxylic acid;tetrakis(2-(methylamino)ethanol).
| Compound Name | benzene-1,2,3,4-tetracarboxylic acid;tetrakis(2-(methylamino)ethanol) |
|---|---|
| PubChem CID | 173051474 |
| Molecular Formula | C22H42N4O12 |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | benzene-1,2,3,4-tetracarboxylic acid;tetrakis(2-(methylamino)ethanol) |
| SMILES | CNCCO.CNCCO.CNCCO.CNCCO.O=C(O)c1ccc(C(=O)O)c(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C10H6O8.4C3H9NO/c11-7(12)3-1-2-4(8(13)14)6(10(17)18)5(3)9(15)16;4*1-4-2-3-5/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18);4*4-5H,2-3H2,1H3 |
| InChIKey | DZCUZNYKHBBFHF-UHFFFAOYSA-N |
| XLogP | -2.73 |
| TPSA | 278.24 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |