C26H24N2O8S2 — CID 88757452
2,3-bis(2-nitro-3-phenylsulfanylpropyl)terephthalic acid (PubChem CID 88757452) has the molecular formula C26H24N2O8S2 and a molecular weight of 556.62 g/mol. Its IUPAC name is 2,3-bis(2-nitro-3-phenylsulfanylpropyl)terephthalic acid.
| Compound Name | 2,3-bis(2-nitro-3-phenylsulfanylpropyl)terephthalic acid |
|---|---|
| PubChem CID | 88757452 |
| Molecular Formula | C26H24N2O8S2 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | 2,3-bis(2-nitro-3-phenylsulfanylpropyl)terephthalic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)c(CC(CSc2ccccc2)[N+](=O)[O-])c1CC(CSc1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C26H24N2O8S2/c29-25(30)21-11-12-22(26(31)32)24(14-18(28(35)36)16-38-20-9-5-2-6-10-20)23(21)13-17(27(33)34)15-37-19-7-3-1-4-8-19/h1-12,17-18H,13-16H2,(H,29,30)(H,31,32) |
| InChIKey | IERJRJUNCBGRAO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|