2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid

C18H22O8 — CID 67861749

IUPAC2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid
SMILESCC(=O)O[C@@H](C)Cc1c(C(=O)O)ccc(C(=O)O)c1C[C@H](C)OC(C)=O
InChIInChI=1S/C18H22O8/c1-9(25-11(3)19)7-15-13(17(21)22)5-6-14(18(23)24)16(15)8-10(2)26-12(4)20/h5-6,9-10H,7-8H2,1-4H3,(H,21,22)(H,23,24)/t9-,10-/m0/s1
InChIKeyQKFYYRLSBZJSPO-UWVGGRQHSA-N
MW366.37 g/mol
LogP2.07
Rot. Bonds8

About 2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid

2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid (PubChem CID 67861749) has the molecular formula C18H22O8 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid.

Molecular Properties

Compound Name2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid
PubChem CID67861749
Molecular FormulaC18H22O8
Molecular Weight366.37 g/mol
Exact Mass366.13
IUPAC Name2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid
SMILESCC(=O)O[C@@H](C)Cc1c(C(=O)O)ccc(C(=O)O)c1C[C@H](C)OC(C)=O
InChIInChI=1S/C18H22O8/c1-9(25-11(3)19)7-15-13(17(21)22)5-6-14(18(23)24)16(15)8-10(2)26-12(4)20/h5-6,9-10H,7-8H2,1-4H3,(H,21,22)(H,23,24)/t9-,10-/m0/s1
InChIKeyQKFYYRLSBZJSPO-UWVGGRQHSA-N
XLogP2.07
TPSA127.20 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500366.37
LogP ≤ 52.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid?
The IUPAC name of 2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid (CID 67861749) is 2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid.
What is the SMILES notation for 2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid?
The canonical SMILES for 2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid is CC(=O)O[C@@H](C)Cc1c(C(=O)O)ccc(C(=O)O)c1C[C@H](C)OC(C)=O.
What is the InChIKey of 2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid?
The InChIKey is QKFYYRLSBZJSPO-UWVGGRQHSA-N. The full InChI is InChI=1S/C18H22O8/c1-9(25-11(3)19)7-15-13(17(21)22)5-6-14(18(23)24)16(15)8-10(2)26-12(4)20/h5-6,9-10H,7-8H2,1-4H3,(H,21,22)(H,23,24)/t9-,10-/m0/s1.
What are the key properties of 2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid?
2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid has a molecular weight of 366.37 g/mol, XLogP of 2.07, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid is sourced from PubChem (CID 67861749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).