C18H22O8 — CID 67861749
2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid (PubChem CID 67861749) has the molecular formula C18H22O8 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid.
| Compound Name | 2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid |
|---|---|
| PubChem CID | 67861749 |
| Molecular Formula | C18H22O8 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2,3-bis[(2S)-2-acetyloxypropyl]terephthalic acid |
| SMILES | CC(=O)O[C@@H](C)Cc1c(C(=O)O)ccc(C(=O)O)c1C[C@H](C)OC(C)=O |
| InChI | InChI=1S/C18H22O8/c1-9(25-11(3)19)7-15-13(17(21)22)5-6-14(18(23)24)16(15)8-10(2)26-12(4)20/h5-6,9-10H,7-8H2,1-4H3,(H,21,22)(H,23,24)/t9-,10-/m0/s1 |
| InChIKey | QKFYYRLSBZJSPO-UWVGGRQHSA-N |
| XLogP | 2.07 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |