C18H22O8 — CID 67865625
bis[(2S)-2-acetyloxypropyl] benzene-1,4-dicarboxylate (PubChem CID 67865625) has the molecular formula C18H22O8 and a molecular weight of 366.37 g/mol. Its IUPAC name is bis[(2S)-2-acetyloxypropyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[(2S)-2-acetyloxypropyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 67865625 |
| Molecular Formula | C18H22O8 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | bis[(2S)-2-acetyloxypropyl] benzene-1,4-dicarboxylate |
| SMILES | CC(=O)O[C@@H](C)COC(=O)c1ccc(C(=O)OC[C@H](C)OC(C)=O)cc1 |
| InChI | InChI=1S/C18H22O8/c1-11(25-13(3)19)9-23-17(21)15-5-7-16(8-6-15)18(22)24-10-12(2)26-14(4)20/h5-8,11-12H,9-10H2,1-4H3/t11-,12-/m0/s1 |
| InChIKey | VZZZXFPIEBUDMH-RYUDHWBXSA-N |
| XLogP | 1.90 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|