About 2-methylpropyl 4-aminobenzoate
2-methylpropyl 4-aminobenzoate (PubChem CID 23616374) has the molecular formula C22H30N2O4
and a molecular weight of 386.49 g/mol. Its IUPAC name is 2-methylpropyl 4-aminobenzoate.
Molecular Properties
| Compound Name | 2-methylpropyl 4-aminobenzoate |
| PubChem CID | 23616374 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 2-methylpropyl 4-aminobenzoate |
| SMILES | CC(C)COC(=O)c1ccc(N)cc1.CC(C)COC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/2C11H15NO2/c2*1-8(2)7-14-11(13)9-3-5-10(12)6-4-9/h2*3-6,8H,7,12H2,1-2H3 |
| InChIKey | YBXOZNBVDAABRX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 4-aminobenzoate?
The IUPAC name of 2-methylpropyl 4-aminobenzoate (CID 23616374) is 2-methylpropyl 4-aminobenzoate.
What is the SMILES notation for 2-methylpropyl 4-aminobenzoate?
The canonical SMILES for 2-methylpropyl 4-aminobenzoate is CC(C)COC(=O)c1ccc(N)cc1.CC(C)COC(=O)c1ccc(N)cc1.
What is the InChIKey of 2-methylpropyl 4-aminobenzoate?
The InChIKey is YBXOZNBVDAABRX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H15NO2/c2*1-8(2)7-14-11(13)9-3-5-10(12)6-4-9/h2*3-6,8H,7,12H2,1-2H3.
What are the key properties of 2-methylpropyl 4-aminobenzoate?
2-methylpropyl 4-aminobenzoate has a molecular weight of 386.49 g/mol, XLogP of 4.16, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 4-aminobenzoate is sourced from PubChem (CID 23616374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).