About 2-methylpropyl 4-hydroxybenzoate;propan-2-yl 4-hydroxybenzoate
2-methylpropyl 4-hydroxybenzoate;propan-2-yl 4-hydroxybenzoate (PubChem CID 70155942) has the molecular formula C21H26O6
and a molecular weight of 374.43 g/mol. Its IUPAC name is 2-methylpropyl 4-hydroxybenzoate;propan-2-yl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | 2-methylpropyl 4-hydroxybenzoate;propan-2-yl 4-hydroxybenzoate |
| PubChem CID | 70155942 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-methylpropyl 4-hydroxybenzoate;propan-2-yl 4-hydroxybenzoate |
| SMILES | CC(C)COC(=O)c1ccc(O)cc1.CC(C)OC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C11H14O3.C10H12O3/c1-8(2)7-14-11(13)9-3-5-10(12)6-4-9;1-7(2)13-10(12)8-3-5-9(11)6-4-8/h3-6,8,12H,7H2,1-2H3;3-7,11H,1-2H3 |
| InChIKey | DNQCSOQXLIJGFI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methylpropyl 4-hydroxybenzoate;propan-2-yl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 4-hydroxybenzoate;propan-2-yl 4-hydroxybenzoate?
The IUPAC name of 2-methylpropyl 4-hydroxybenzoate;propan-2-yl 4-hydroxybenzoate (CID 70155942) is 2-methylpropyl 4-hydroxybenzoate;propan-2-yl 4-hydroxybenzoate.
What is the SMILES notation for 2-methylpropyl 4-hydroxybenzoate;propan-2-yl 4-hydroxybenzoate?
The canonical SMILES for 2-methylpropyl 4-hydroxybenzoate;propan-2-yl 4-hydroxybenzoate is CC(C)COC(=O)c1ccc(O)cc1.CC(C)OC(=O)c1ccc(O)cc1.
What is the InChIKey of 2-methylpropyl 4-hydroxybenzoate;propan-2-yl 4-hydroxybenzoate?
The InChIKey is DNQCSOQXLIJGFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3.C10H12O3/c1-8(2)7-14-11(13)9-3-5-10(12)6-4-9;1-7(2)13-10(12)8-3-5-9(11)6-4-8/h3-6,8,12H,7H2,1-2H3;3-7,11H,1-2H3.
What are the key properties of 2-methylpropyl 4-hydroxybenzoate;propan-2-yl 4-hydroxybenzoate?
2-methylpropyl 4-hydroxybenzoate;propan-2-yl 4-hydroxybenzoate has a molecular weight of 374.43 g/mol, XLogP of 4.16, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 4-hydroxybenzoate;propan-2-yl 4-hydroxybenzoate is sourced from PubChem (CID 70155942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).