About bis(propan-2-yl 4-hydroxybenzoate);zinc
bis(propan-2-yl 4-hydroxybenzoate);zinc (PubChem CID 122130630) has the molecular formula C20H24O6Zn
and a molecular weight of 425.80 g/mol. Its IUPAC name is bis(propan-2-yl 4-hydroxybenzoate);zinc.
Molecular Properties
| Compound Name | bis(propan-2-yl 4-hydroxybenzoate);zinc |
| PubChem CID | 122130630 |
| Molecular Formula | C20H24O6Zn |
| Molecular Weight | 425.80 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | bis(propan-2-yl 4-hydroxybenzoate);zinc |
| SMILES | CC(C)OC(=O)c1ccc(O)cc1.CC(C)OC(=O)c1ccc(O)cc1.[Zn] |
| InChI | InChI=1S/2C10H12O3.Zn/c2*1-7(2)13-10(12)8-3-5-9(11)6-4-8;/h2*3-7,11H,1-2H3; |
| InChIKey | GFTOJLRKENXRDZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.80 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(propan-2-yl 4-hydroxybenzoate);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(propan-2-yl 4-hydroxybenzoate);zinc?
The IUPAC name of bis(propan-2-yl 4-hydroxybenzoate);zinc (CID 122130630) is bis(propan-2-yl 4-hydroxybenzoate);zinc.
What is the SMILES notation for bis(propan-2-yl 4-hydroxybenzoate);zinc?
The canonical SMILES for bis(propan-2-yl 4-hydroxybenzoate);zinc is CC(C)OC(=O)c1ccc(O)cc1.CC(C)OC(=O)c1ccc(O)cc1.[Zn].
What is the InChIKey of bis(propan-2-yl 4-hydroxybenzoate);zinc?
The InChIKey is GFTOJLRKENXRDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H12O3.Zn/c2*1-7(2)13-10(12)8-3-5-9(11)6-4-8;/h2*3-7,11H,1-2H3;.
What are the key properties of bis(propan-2-yl 4-hydroxybenzoate);zinc?
bis(propan-2-yl 4-hydroxybenzoate);zinc has a molecular weight of 425.80 g/mol, XLogP of 3.91, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(propan-2-yl 4-hydroxybenzoate);zinc is sourced from PubChem (CID 122130630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).