About 1-fluoroethyl 4-hydroxybenzoate
1-fluoroethyl 4-hydroxybenzoate (PubChem CID 175530732) has the molecular formula C9H9FO3
and a molecular weight of 184.17 g/mol. Its IUPAC name is 1-fluoroethyl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | 1-fluoroethyl 4-hydroxybenzoate |
| PubChem CID | 175530732 |
| Molecular Formula | C9H9FO3 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 1-fluoroethyl 4-hydroxybenzoate |
| SMILES | CC(F)OC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H9FO3/c1-6(10)13-9(12)7-2-4-8(11)5-3-7/h2-6,11H,1H3 |
| InChIKey | PUWFMDQYRYUWCB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-fluoroethyl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroethyl 4-hydroxybenzoate?
The IUPAC name of 1-fluoroethyl 4-hydroxybenzoate (CID 175530732) is 1-fluoroethyl 4-hydroxybenzoate.
What is the SMILES notation for 1-fluoroethyl 4-hydroxybenzoate?
The canonical SMILES for 1-fluoroethyl 4-hydroxybenzoate is CC(F)OC(=O)c1ccc(O)cc1.
What is the InChIKey of 1-fluoroethyl 4-hydroxybenzoate?
The InChIKey is PUWFMDQYRYUWCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FO3/c1-6(10)13-9(12)7-2-4-8(11)5-3-7/h2-6,11H,1H3.
What are the key properties of 1-fluoroethyl 4-hydroxybenzoate?
1-fluoroethyl 4-hydroxybenzoate has a molecular weight of 184.17 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroethyl 4-hydroxybenzoate is sourced from PubChem (CID 175530732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).