C13H11F6O7S2- — CID 58195694
4,4-bis(trifluoromethylsulfonyl)butan-2-yl 4-hydroxybenzoate (PubChem CID 58195694) has the molecular formula C13H11F6O7S2- and a molecular weight of 457.35 g/mol. Its IUPAC name is 4,4-bis(trifluoromethylsulfonyl)butan-2-yl 4-hydroxybenzoate.
| Compound Name | 4,4-bis(trifluoromethylsulfonyl)butan-2-yl 4-hydroxybenzoate |
|---|---|
| PubChem CID | 58195694 |
| Molecular Formula | C13H11F6O7S2- |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 456.99 |
| IUPAC Name | 4,4-bis(trifluoromethylsulfonyl)butan-2-yl 4-hydroxybenzoate |
| SMILES | CC(C[C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)OC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H11F6O7S2/c1-7(26-11(21)8-2-4-9(20)5-3-8)6-10(27(22,23)12(14,15)16)28(24,25)13(17,18)19/h2-5,7,20H,6H2,1H3/q-1 |
| InChIKey | QQWLPWCDWCNAEB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|