C13H11F6O8S2- — CID 58195747
4,4-bis(trifluoromethylsulfonyl)butan-2-yl (4-hydroxyphenyl) carbonate (PubChem CID 58195747) has the molecular formula C13H11F6O8S2- and a molecular weight of 473.35 g/mol. Its IUPAC name is 4,4-bis(trifluoromethylsulfonyl)butan-2-yl (4-hydroxyphenyl) carbonate.
| Compound Name | 4,4-bis(trifluoromethylsulfonyl)butan-2-yl (4-hydroxyphenyl) carbonate |
|---|---|
| PubChem CID | 58195747 |
| Molecular Formula | C13H11F6O8S2- |
| Molecular Weight | 473.35 g/mol |
| Exact Mass | 472.98 |
| IUPAC Name | 4,4-bis(trifluoromethylsulfonyl)butan-2-yl (4-hydroxyphenyl) carbonate |
| SMILES | CC(C[C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)OC(=O)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C13H11F6O8S2/c1-7(26-11(21)27-9-4-2-8(20)3-5-9)6-10(28(22,23)12(14,15)16)29(24,25)13(17,18)19/h2-5,7,20H,6H2,1H3/q-1 |
| InChIKey | OOBNFTWVZCRWCY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|