C17H26O3 — CID 123932868
(4-hydroxyphenyl) 2,4,4-trimethyl-2-propan-2-ylpentanoate (PubChem CID 123932868) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (4-hydroxyphenyl) 2,4,4-trimethyl-2-propan-2-ylpentanoate.
| Compound Name | (4-hydroxyphenyl) 2,4,4-trimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 123932868 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (4-hydroxyphenyl) 2,4,4-trimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)C(C)(CC(C)(C)C)C(=O)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C17H26O3/c1-12(2)17(6,11-16(3,4)5)15(19)20-14-9-7-13(18)8-10-14/h7-10,12,18H,11H2,1-6H3 |
| InChIKey | CISINROQVNBJKL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|