C16H32O3 — CID 123702828
1-propan-2-yloxyethyl 2,4,4-trimethyl-2-propan-2-ylpentanoate (PubChem CID 123702828) has the molecular formula C16H32O3 and a molecular weight of 272.43 g/mol. Its IUPAC name is 1-propan-2-yloxyethyl 2,4,4-trimethyl-2-propan-2-ylpentanoate.
| Compound Name | 1-propan-2-yloxyethyl 2,4,4-trimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 123702828 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | 1-propan-2-yloxyethyl 2,4,4-trimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)OC(C)OC(=O)C(C)(CC(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H32O3/c1-11(2)16(9,10-15(6,7)8)14(17)19-13(5)18-12(3)4/h11-13H,10H2,1-9H3 |
| InChIKey | QRMYHVJBIPXEIX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|