C16H24F8O2 — CID 89217627
2,2,3,3,4,4,5,5-octafluoropentyl 2,4,4-trimethyl-2-propan-2-ylpentanoate (PubChem CID 89217627) has the molecular formula C16H24F8O2 and a molecular weight of 400.35 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl 2,4,4-trimethyl-2-propan-2-ylpentanoate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2,4,4-trimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 89217627 |
| Molecular Formula | C16H24F8O2 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2,4,4-trimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)C(C)(CC(C)(C)C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C16H24F8O2/c1-9(2)13(6,7-12(3,4)5)11(25)26-8-14(19,20)16(23,24)15(21,22)10(17)18/h9-10H,7-8H2,1-6H3 |
| InChIKey | BDKPZDWOUHWQLS-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|