C14H21F7O2 — CID 88580459
2,2,3,3,4,4,4-heptafluorobutyl 2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 88580459) has the molecular formula C14H21F7O2 and a molecular weight of 354.31 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutyl 2,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutyl 2,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 88580459 |
| Molecular Formula | C14H21F7O2 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 2,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)CC(C)(C(=O)OCC(F)(F)C(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C14H21F7O2/c1-8(2)6-11(5,9(3)4)10(22)23-7-12(15,16)13(17,18)14(19,20)21/h8-9H,6-7H2,1-5H3 |
| InChIKey | HNHISAXDTKYAEO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|