C16H28F2O7S — CID 163802492
2-[4-[(2S)-2,4-dimethyl-2-propan-2-ylpentanoyl]oxybutoxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 163802492) has the molecular formula C16H28F2O7S and a molecular weight of 402.46 g/mol. Its IUPAC name is 2-[4-[(2S)-2,4-dimethyl-2-propan-2-ylpentanoyl]oxybutoxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[4-[(2S)-2,4-dimethyl-2-propan-2-ylpentanoyl]oxybutoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 163802492 |
| Molecular Formula | C16H28F2O7S |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-[4-[(2S)-2,4-dimethyl-2-propan-2-ylpentanoyl]oxybutoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CC(C)C[C@](C)(C(=O)OCCCCOC(=O)C(F)(F)S(=O)(=O)O)C(C)C |
| InChI | InChI=1S/C16H28F2O7S/c1-11(2)10-15(5,12(3)4)13(19)24-8-6-7-9-25-14(20)16(17,18)26(21,22)23/h11-12H,6-10H2,1-5H3,(H,21,22,23)/t15-/m0/s1 |
| InChIKey | NGFAEISWWRTFGT-HNNXBMFYSA-N |
| XLogP | 3.04 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|