C21H33F3N2O4 — CID 170125949
6-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]hexyl 2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 170125949) has the molecular formula C21H33F3N2O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 6-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]hexyl 2,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | 6-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]hexyl 2,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 170125949 |
| Molecular Formula | C21H33F3N2O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 6-[2,4-dioxo-5-(trifluoromethyl)-1H-pyrimidin-3-yl]hexyl 2,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)CC(C)(C(=O)OCCCCCCn1c(=O)[nH]cc(C(F)(F)F)c1=O)C(C)C |
| InChI | InChI=1S/C21H33F3N2O4/c1-14(2)12-20(5,15(3)4)18(28)30-11-9-7-6-8-10-26-17(27)16(21(22,23)24)13-25-19(26)29/h13-15H,6-12H2,1-5H3,(H,25,29) |
| InChIKey | FAXNXOJOQKXPCE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|