C20H32N2O3S2 — CID 170126028
[6-[2,4-bis(sulfanylidene)-1H-pyrimidin-3-yl]-6-oxohexyl] 2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 170126028) has the molecular formula C20H32N2O3S2 and a molecular weight of 412.62 g/mol. Its IUPAC name is [6-[2,4-bis(sulfanylidene)-1H-pyrimidin-3-yl]-6-oxohexyl] 2,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | [6-[2,4-bis(sulfanylidene)-1H-pyrimidin-3-yl]-6-oxohexyl] 2,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 170126028 |
| Molecular Formula | C20H32N2O3S2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | [6-[2,4-bis(sulfanylidene)-1H-pyrimidin-3-yl]-6-oxohexyl] 2,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)CC(C)(C(=O)OCCCCCC(=O)n1c(=S)cc[nH]c1=S)C(C)C |
| InChI | InChI=1S/C20H32N2O3S2/c1-14(2)13-20(5,15(3)4)18(24)25-12-8-6-7-9-16(23)22-17(26)10-11-21-19(22)27/h10-11,14-15H,6-9,12-13H2,1-5H3,(H,21,27) |
| InChIKey | DDLUWJNVLUQULX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|