C19H32N2O2S2 — CID 170125884
6-[2,4-bis(sulfanylidene)-1H-pyrimidin-3-yl]hexyl 4-methyl-2-propan-2-ylpentanoate (PubChem CID 170125884) has the molecular formula C19H32N2O2S2 and a molecular weight of 384.61 g/mol. Its IUPAC name is 6-[2,4-bis(sulfanylidene)-1H-pyrimidin-3-yl]hexyl 4-methyl-2-propan-2-ylpentanoate.
| Compound Name | 6-[2,4-bis(sulfanylidene)-1H-pyrimidin-3-yl]hexyl 4-methyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 170125884 |
| Molecular Formula | C19H32N2O2S2 |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 6-[2,4-bis(sulfanylidene)-1H-pyrimidin-3-yl]hexyl 4-methyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)CC(C(=O)OCCCCCCn1c(=S)cc[nH]c1=S)C(C)C |
| InChI | InChI=1S/C19H32N2O2S2/c1-14(2)13-16(15(3)4)18(22)23-12-8-6-5-7-11-21-17(24)9-10-20-19(21)25/h9-10,14-16H,5-8,11-13H2,1-4H3,(H,20,25) |
| InChIKey | BMZPWVKOKXVNBC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|