About ethyl (2R)-4-methyl-2-propan-2-ylpentanoate;2-methylpropylbenzene
ethyl (2R)-4-methyl-2-propan-2-ylpentanoate;2-methylpropylbenzene (PubChem CID 158350674) has the molecular formula C21H36O2
and a molecular weight of 320.52 g/mol. Its IUPAC name is ethyl (2R)-4-methyl-2-propan-2-ylpentanoate;2-methylpropylbenzene.
Molecular Properties
| Compound Name | ethyl (2R)-4-methyl-2-propan-2-ylpentanoate;2-methylpropylbenzene |
| PubChem CID | 158350674 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | ethyl (2R)-4-methyl-2-propan-2-ylpentanoate;2-methylpropylbenzene |
| SMILES | CC(C)Cc1ccccc1.CCOC(=O)[C@H](CC(C)C)C(C)C |
| InChI | InChI=1S/C11H22O2.C10H14/c1-6-13-11(12)10(9(4)5)7-8(2)3;1-9(2)8-10-6-4-3-5-7-10/h8-10H,6-7H2,1-5H3;3-7,9H,8H2,1-2H3/t10-;/m1./s1 |
| InChIKey | GSGUICJJRRBWES-HNCPQSOCSA-N |
| XLogP | 5.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl (2R)-4-methyl-2-propan-2-ylpentanoate;2-methylpropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-4-methyl-2-propan-2-ylpentanoate;2-methylpropylbenzene?
The IUPAC name of ethyl (2R)-4-methyl-2-propan-2-ylpentanoate;2-methylpropylbenzene (CID 158350674) is ethyl (2R)-4-methyl-2-propan-2-ylpentanoate;2-methylpropylbenzene.
What is the SMILES notation for ethyl (2R)-4-methyl-2-propan-2-ylpentanoate;2-methylpropylbenzene?
The canonical SMILES for ethyl (2R)-4-methyl-2-propan-2-ylpentanoate;2-methylpropylbenzene is CC(C)Cc1ccccc1.CCOC(=O)[C@H](CC(C)C)C(C)C.
What is the InChIKey of ethyl (2R)-4-methyl-2-propan-2-ylpentanoate;2-methylpropylbenzene?
The InChIKey is GSGUICJJRRBWES-HNCPQSOCSA-N. The full InChI is InChI=1S/C11H22O2.C10H14/c1-6-13-11(12)10(9(4)5)7-8(2)3;1-9(2)8-10-6-4-3-5-7-10/h8-10H,6-7H2,1-5H3;3-7,9H,8H2,1-2H3/t10-;/m1./s1.
What are the key properties of ethyl (2R)-4-methyl-2-propan-2-ylpentanoate;2-methylpropylbenzene?
ethyl (2R)-4-methyl-2-propan-2-ylpentanoate;2-methylpropylbenzene has a molecular weight of 320.52 g/mol, XLogP of 5.75, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-4-methyl-2-propan-2-ylpentanoate;2-methylpropylbenzene is sourced from PubChem (CID 158350674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).