About 6-(2,4-dioxo-5-phenylpyrimidin-1-yl)hexyl 4-methyl-2-propan-2-ylpentanoate
6-(2,4-dioxo-5-phenylpyrimidin-1-yl)hexyl 4-methyl-2-propan-2-ylpentanoate (PubChem CID 170125707) has the molecular formula C25H36N2O4
and a molecular weight of 428.57 g/mol. Its IUPAC name is 6-(2,4-dioxo-5-phenylpyrimidin-1-yl)hexyl 4-methyl-2-propan-2-ylpentanoate.
Molecular Properties
| Compound Name | 6-(2,4-dioxo-5-phenylpyrimidin-1-yl)hexyl 4-methyl-2-propan-2-ylpentanoate |
| PubChem CID | 170125707 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 6-(2,4-dioxo-5-phenylpyrimidin-1-yl)hexyl 4-methyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)CC(C(=O)OCCCCCCn1cc(-c2ccccc2)c(=O)[nH]c1=O)C(C)C |
| InChI | InChI=1S/C25H36N2O4/c1-18(2)16-21(19(3)4)24(29)31-15-11-6-5-10-14-27-17-22(23(28)26-25(27)30)20-12-8-7-9-13-20/h7-9,12-13,17-19,21H,5-6,10-11,14-16H2,1-4H3,(H,26,28,30) |
| InChIKey | HMLFVWXPYJMOPN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,4-dioxo-5-phenylpyrimidin-1-yl)hexyl 4-methyl-2-propan-2-ylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,4-dioxo-5-phenylpyrimidin-1-yl)hexyl 4-methyl-2-propan-2-ylpentanoate?
The IUPAC name of 6-(2,4-dioxo-5-phenylpyrimidin-1-yl)hexyl 4-methyl-2-propan-2-ylpentanoate (CID 170125707) is 6-(2,4-dioxo-5-phenylpyrimidin-1-yl)hexyl 4-methyl-2-propan-2-ylpentanoate.
What is the SMILES notation for 6-(2,4-dioxo-5-phenylpyrimidin-1-yl)hexyl 4-methyl-2-propan-2-ylpentanoate?
The canonical SMILES for 6-(2,4-dioxo-5-phenylpyrimidin-1-yl)hexyl 4-methyl-2-propan-2-ylpentanoate is CC(C)CC(C(=O)OCCCCCCn1cc(-c2ccccc2)c(=O)[nH]c1=O)C(C)C.
What is the InChIKey of 6-(2,4-dioxo-5-phenylpyrimidin-1-yl)hexyl 4-methyl-2-propan-2-ylpentanoate?
The InChIKey is HMLFVWXPYJMOPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H36N2O4/c1-18(2)16-21(19(3)4)24(29)31-15-11-6-5-10-14-27-17-22(23(28)26-25(27)30)20-12-8-7-9-13-20/h7-9,12-13,17-19,21H,5-6,10-11,14-16H2,1-4H3,(H,26,28,30).
What are the key properties of 6-(2,4-dioxo-5-phenylpyrimidin-1-yl)hexyl 4-methyl-2-propan-2-ylpentanoate?
6-(2,4-dioxo-5-phenylpyrimidin-1-yl)hexyl 4-methyl-2-propan-2-ylpentanoate has a molecular weight of 428.57 g/mol, XLogP of 4.63, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,4-dioxo-5-phenylpyrimidin-1-yl)hexyl 4-methyl-2-propan-2-ylpentanoate is sourced from PubChem (CID 170125707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).