C20H24N2O4S — CID 169034342
[6-oxo-6-(4-oxo-5-phenyl-2-sulfanylidenepyrimidin-1-yl)hexyl] 2-methylpropanoate (PubChem CID 169034342) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is [6-oxo-6-(4-oxo-5-phenyl-2-sulfanylidenepyrimidin-1-yl)hexyl] 2-methylpropanoate.
| Compound Name | [6-oxo-6-(4-oxo-5-phenyl-2-sulfanylidenepyrimidin-1-yl)hexyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 169034342 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | [6-oxo-6-(4-oxo-5-phenyl-2-sulfanylidenepyrimidin-1-yl)hexyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCCCCC(=O)n1cc(-c2ccccc2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C20H24N2O4S/c1-14(2)19(25)26-12-8-4-7-11-17(23)22-13-16(18(24)21-20(22)27)15-9-5-3-6-10-15/h3,5-6,9-10,13-14H,4,7-8,11-12H2,1-2H3,(H,21,24,27) |
| InChIKey | WRPYUDYYQXJPBY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|